C19H27F3N4O3 — CID 178127315
ethane;methanol;1-piperidin-1-yl-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]ethanone (PubChem CID 178127315) has the molecular formula C19H27F3N4O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is ethane;methanol;1-piperidin-1-yl-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]ethanone.
| Compound Name | ethane;methanol;1-piperidin-1-yl-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]ethanone |
|---|---|
| PubChem CID | 178127315 |
| Molecular Formula | C19H27F3N4O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ethane;methanol;1-piperidin-1-yl-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]ethanone |
| SMILES | CC.CO.O=C(CNc1ncnc2cc(OC(F)(F)F)ccc12)N1CCCCC1 |
| InChI | InChI=1S/C16H17F3N4O2.C2H6.CH4O/c17-16(18,19)25-11-4-5-12-13(8-11)21-10-22-15(12)20-9-14(24)23-6-2-1-3-7-23;2*1-2/h4-5,8,10H,1-3,6-7,9H2,(H,20,21,22);1-2H3;2H,1H3 |
| InChIKey | NYLMWLLUFSVNSY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |