C14H15ClF2N4O — CID 178127443
1-(azetidin-1-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone;difluoromethane (PubChem CID 178127443) has the molecular formula C14H15ClF2N4O and a molecular weight of 328.75 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone;difluoromethane.
| Compound Name | 1-(azetidin-1-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone;difluoromethane |
|---|---|
| PubChem CID | 178127443 |
| Molecular Formula | C14H15ClF2N4O |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 1-(azetidin-1-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone;difluoromethane |
| SMILES | FCF.O=C(CNc1ncnc2cc(Cl)ccc12)N1CCC1 |
| InChI | InChI=1S/C13H13ClN4O.CH2F2/c14-9-2-3-10-11(6-9)16-8-17-13(10)15-7-12(19)18-4-1-5-18;2-1-3/h2-3,6,8H,1,4-5,7H2,(H,15,16,17);1H2 |
| InChIKey | PNUIBJHRERLISK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |