C16H17ClN4O — CID 178127178
1-(2-azaspiro[3.3]heptan-2-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone (PubChem CID 178127178) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-(2-azaspiro[3.3]heptan-2-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone.
| Compound Name | 1-(2-azaspiro[3.3]heptan-2-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone |
|---|---|
| PubChem CID | 178127178 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(2-azaspiro[3.3]heptan-2-yl)-2-[(7-chloroquinazolin-4-yl)amino]ethanone |
| SMILES | O=C(CNc1ncnc2cc(Cl)ccc12)N1CC2(CCC2)C1 |
| InChI | InChI=1S/C16H17ClN4O/c17-11-2-3-12-13(6-11)19-10-20-15(12)18-7-14(22)21-8-16(9-21)4-1-5-16/h2-3,6,10H,1,4-5,7-9H2,(H,18,19,20) |
| InChIKey | ARNLJFDNPIELLO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |