C15H22ClN3 — CID 156733545
7-chloro-N-(3-methylbutyl)quinazolin-4-amine;ethane (PubChem CID 156733545) has the molecular formula C15H22ClN3 and a molecular weight of 279.82 g/mol. Its IUPAC name is 7-chloro-N-(3-methylbutyl)quinazolin-4-amine;ethane.
| Compound Name | 7-chloro-N-(3-methylbutyl)quinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 156733545 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.82 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 7-chloro-N-(3-methylbutyl)quinazolin-4-amine;ethane |
| SMILES | CC.CC(C)CCNc1ncnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H16ClN3.C2H6/c1-9(2)5-6-15-13-11-4-3-10(14)7-12(11)16-8-17-13;1-2/h3-4,7-9H,5-6H2,1-2H3,(H,15,16,17);1-2H3 |
| InChIKey | CVCXBLFWEUFBQD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |