C20H24N4 — CID 69016704
6-[4-(methylamino)phenyl]-N-(3-methylbutyl)quinazolin-4-amine (PubChem CID 69016704) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 6-[4-(methylamino)phenyl]-N-(3-methylbutyl)quinazolin-4-amine.
| Compound Name | 6-[4-(methylamino)phenyl]-N-(3-methylbutyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 69016704 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 6-[4-(methylamino)phenyl]-N-(3-methylbutyl)quinazolin-4-amine |
| SMILES | CNc1ccc(-c2ccc3ncnc(NCCC(C)C)c3c2)cc1 |
| InChI | InChI=1S/C20H24N4/c1-14(2)10-11-22-20-18-12-16(6-9-19(18)23-13-24-20)15-4-7-17(21-3)8-5-15/h4-9,12-14,21H,10-11H2,1-3H3,(H,22,23,24) |
| InChIKey | ZIMYANOWJFKAPY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |