C27H33N5O2 — CID 69016016
prop-2-enyl 4-[4-[4-(3-methylbutylamino)quinazolin-6-yl]phenyl]piperazine-1-carboxylate (PubChem CID 69016016) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is prop-2-enyl 4-[4-[4-(3-methylbutylamino)quinazolin-6-yl]phenyl]piperazine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[4-[4-(3-methylbutylamino)quinazolin-6-yl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69016016 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | prop-2-enyl 4-[4-[4-(3-methylbutylamino)quinazolin-6-yl]phenyl]piperazine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCN(c2ccc(-c3ccc4ncnc(NCCC(C)C)c4c3)cc2)CC1 |
| InChI | InChI=1S/C27H33N5O2/c1-4-17-34-27(33)32-15-13-31(14-16-32)23-8-5-21(6-9-23)22-7-10-25-24(18-22)26(30-19-29-25)28-12-11-20(2)3/h4-10,18-20H,1,11-17H2,2-3H3,(H,28,29,30) |
| InChIKey | MXBMFCCJFYQDBW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|