C23H29N3 — CID 69015459
6-(4-butylphenyl)-N-(3-methylbutyl)quinazolin-4-amine (PubChem CID 69015459) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is 6-(4-butylphenyl)-N-(3-methylbutyl)quinazolin-4-amine.
| Compound Name | 6-(4-butylphenyl)-N-(3-methylbutyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 69015459 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 6-(4-butylphenyl)-N-(3-methylbutyl)quinazolin-4-amine |
| SMILES | CCCCc1ccc(-c2ccc3ncnc(NCCC(C)C)c3c2)cc1 |
| InChI | InChI=1S/C23H29N3/c1-4-5-6-18-7-9-19(10-8-18)20-11-12-22-21(15-20)23(26-16-25-22)24-14-13-17(2)3/h7-12,15-17H,4-6,13-14H2,1-3H3,(H,24,25,26) |
| InChIKey | MMIXWHRUURYCLH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |