C29H26N3S3+ — CID 172692143
N-(3-methylbutyl)-6-(1-thianthren-1-ylthiophen-1-ium-3-yl)quinazolin-4-amine (PubChem CID 172692143) has the molecular formula C29H26N3S3+ and a molecular weight of 512.75 g/mol. Its IUPAC name is N-(3-methylbutyl)-6-(1-thianthren-1-ylthiophen-1-ium-3-yl)quinazolin-4-amine.
| Compound Name | N-(3-methylbutyl)-6-(1-thianthren-1-ylthiophen-1-ium-3-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 172692143 |
| Molecular Formula | C29H26N3S3+ |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | N-(3-methylbutyl)-6-(1-thianthren-1-ylthiophen-1-ium-3-yl)quinazolin-4-amine |
| SMILES | CC(C)CCNc1ncnc2ccc(-c3cc[s+](-c4cccc5c4Sc4ccccc4S5)c3)cc12 |
| InChI | InChI=1S/C29H26N3S3/c1-19(2)12-14-30-29-22-16-20(10-11-23(22)31-18-32-29)21-13-15-35(17-21)27-9-5-8-26-28(27)34-25-7-4-3-6-24(25)33-26/h3-11,13,15-19H,12,14H2,1-2H3,(H,30,31,32)/q+1 |
| InChIKey | BVBMGTDUNPWGQZ-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|