C24H32N4O3 — CID 87657131
1-azabicyclo[4.1.0]hept-3-en-7-one;tert-butyl 4-(3-methylbutylamino)quinazoline-6-carboxylate (PubChem CID 87657131) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-azabicyclo[4.1.0]hept-3-en-7-one;tert-butyl 4-(3-methylbutylamino)quinazoline-6-carboxylate.
| Compound Name | 1-azabicyclo[4.1.0]hept-3-en-7-one;tert-butyl 4-(3-methylbutylamino)quinazoline-6-carboxylate |
|---|---|
| PubChem CID | 87657131 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 1-azabicyclo[4.1.0]hept-3-en-7-one;tert-butyl 4-(3-methylbutylamino)quinazoline-6-carboxylate |
| SMILES | CC(C)CCNc1ncnc2ccc(C(=O)OC(C)(C)C)cc12.O=C1C2CC=CCN12 |
| InChI | InChI=1S/C18H25N3O2.C6H7NO/c1-12(2)8-9-19-16-14-10-13(17(22)23-18(3,4)5)6-7-15(14)20-11-21-16;8-6-5-3-1-2-4-7(5)6/h6-7,10-12H,8-9H2,1-5H3,(H,19,20,21);1-2,5H,3-4H2 |
| InChIKey | DRXLQVDUARFLIT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|