C22H23N5O4 — CID 162658292
ethyl 4-[(4-morpholin-4-ylquinazolin-2-yl)carbamoylamino]benzoate (PubChem CID 162658292) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is ethyl 4-[(4-morpholin-4-ylquinazolin-2-yl)carbamoylamino]benzoate.
| Compound Name | ethyl 4-[(4-morpholin-4-ylquinazolin-2-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 162658292 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | ethyl 4-[(4-morpholin-4-ylquinazolin-2-yl)carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2nc(N3CCOCC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H23N5O4/c1-2-31-20(28)15-7-9-16(10-8-15)23-22(29)26-21-24-18-6-4-3-5-17(18)19(25-21)27-11-13-30-14-12-27/h3-10H,2,11-14H2,1H3,(H2,23,24,25,26,29) |
| InChIKey | HIPLESZYAYBOPC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |