C22H22N6 — CID 3234456
6-[4-(dimethylamino)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]quinazolin-4-amine (PubChem CID 3234456) has the molecular formula C22H22N6 and a molecular weight of 370.46 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]quinazolin-4-amine.
| Compound Name | 6-[4-(dimethylamino)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 3234456 |
| Molecular Formula | C22H22N6 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]quinazolin-4-amine |
| SMILES | Cc1cnc(CNc2ncnc3ccc(-c4ccc(N(C)C)cc4)cc23)cn1 |
| InChI | InChI=1S/C22H22N6/c1-15-11-24-18(12-23-15)13-25-22-20-10-17(6-9-21(20)26-14-27-22)16-4-7-19(8-5-16)28(2)3/h4-12,14H,13H2,1-3H3,(H,25,26,27) |
| InChIKey | JBTIXYZABMASJD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |