C17H15Cl2N3 — CID 166321938
7-chloro-N-[2-(3-chlorophenyl)propyl]quinazolin-4-amine (PubChem CID 166321938) has the molecular formula C17H15Cl2N3 and a molecular weight of 332.23 g/mol. Its IUPAC name is 7-chloro-N-[2-(3-chlorophenyl)propyl]quinazolin-4-amine.
| Compound Name | 7-chloro-N-[2-(3-chlorophenyl)propyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 166321938 |
| Molecular Formula | C17H15Cl2N3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 7-chloro-N-[2-(3-chlorophenyl)propyl]quinazolin-4-amine |
| SMILES | CC(CNc1ncnc2cc(Cl)ccc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N3/c1-11(12-3-2-4-13(18)7-12)9-20-17-15-6-5-14(19)8-16(15)21-10-22-17/h2-8,10-11H,9H2,1H3,(H,20,21,22) |
| InChIKey | MCWKROJOEWDSRV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |