C14H12ClN3O2 — CID 110889677
2-[(7-chloroquinazolin-4-yl)amino]-1-(furan-2-yl)ethanol (PubChem CID 110889677) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-[(7-chloroquinazolin-4-yl)amino]-1-(furan-2-yl)ethanol.
| Compound Name | 2-[(7-chloroquinazolin-4-yl)amino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 110889677 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[(7-chloroquinazolin-4-yl)amino]-1-(furan-2-yl)ethanol |
| SMILES | OC(CNc1ncnc2cc(Cl)ccc12)c1ccco1 |
| InChI | InChI=1S/C14H12ClN3O2/c15-9-3-4-10-11(6-9)17-8-18-14(10)16-7-12(19)13-2-1-5-20-13/h1-6,8,12,19H,7H2,(H,16,17,18) |
| InChIKey | ATCCRLRGFCBXCB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |