C15H13ClN4 — CID 36722460
7-chloro-N-(2-pyridin-3-ylethyl)quinazolin-4-amine (PubChem CID 36722460) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is 7-chloro-N-(2-pyridin-3-ylethyl)quinazolin-4-amine.
| Compound Name | 7-chloro-N-(2-pyridin-3-ylethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 36722460 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 7-chloro-N-(2-pyridin-3-ylethyl)quinazolin-4-amine |
| SMILES | Clc1ccc2c(NCCc3cccnc3)ncnc2c1 |
| InChI | InChI=1S/C15H13ClN4/c16-12-3-4-13-14(8-12)19-10-20-15(13)18-7-5-11-2-1-6-17-9-11/h1-4,6,8-10H,5,7H2,(H,18,19,20) |
| InChIKey | WEWQOAVBGJKOQZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |