C20H23F3N4O3 — CID 178126900
(2R)-1-[(2R,4S)-2-ethenyl-4-methoxypiperidin-1-yl]-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]propan-1-one (PubChem CID 178126900) has the molecular formula C20H23F3N4O3 and a molecular weight of 424.42 g/mol. Its IUPAC name is (2R)-1-[(2R,4S)-2-ethenyl-4-methoxypiperidin-1-yl]-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]propan-1-one.
| Compound Name | (2R)-1-[(2R,4S)-2-ethenyl-4-methoxypiperidin-1-yl]-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]propan-1-one |
|---|---|
| PubChem CID | 178126900 |
| Molecular Formula | C20H23F3N4O3 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (2R)-1-[(2R,4S)-2-ethenyl-4-methoxypiperidin-1-yl]-2-[[7-(trifluoromethoxy)quinazolin-4-yl]amino]propan-1-one |
| SMILES | C=C[C@H]1C[C@@H](OC)CCN1C(=O)[C@@H](C)Nc1ncnc2cc(OC(F)(F)F)ccc12 |
| InChI | InChI=1S/C20H23F3N4O3/c1-4-13-9-14(29-3)7-8-27(13)19(28)12(2)26-18-16-6-5-15(30-20(21,22)23)10-17(16)24-11-25-18/h4-6,10-14H,1,7-9H2,2-3H3,(H,24,25,26)/t12-,13+,14+/m1/s1 |
| InChIKey | FAEIRARLCJXUBA-RDBSUJKOSA-N |
| XLogP | 3.52 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|