C26H29F3N4O2 — CID 126745159
(5-propylazocan-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone (PubChem CID 126745159) has the molecular formula C26H29F3N4O2 and a molecular weight of 486.54 g/mol. Its IUPAC name is (5-propylazocan-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone.
| Compound Name | (5-propylazocan-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone |
|---|---|
| PubChem CID | 126745159 |
| Molecular Formula | C26H29F3N4O2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (5-propylazocan-1-yl)-[4-[4-(trifluoromethoxy)anilino]quinazolin-7-yl]methanone |
| SMILES | CCCC1CCCN(C(=O)c2ccc3c(Nc4ccc(OC(F)(F)F)cc4)ncnc3c2)CCC1 |
| InChI | InChI=1S/C26H29F3N4O2/c1-2-5-18-6-3-14-33(15-4-7-18)25(34)19-8-13-22-23(16-19)30-17-31-24(22)32-20-9-11-21(12-10-20)35-26(27,28)29/h8-13,16-18H,2-7,14-15H2,1H3,(H,30,31,32) |
| InChIKey | MXJFXESVWNJWQQ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |