C23H24F3N5O — CID 21273959
N-[(1-ethylpyrrolidin-2-yl)methyl]-4-[[7-(trifluoromethyl)quinazolin-4-yl]amino]benzamide (PubChem CID 21273959) has the molecular formula C23H24F3N5O and a molecular weight of 443.47 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-4-[[7-(trifluoromethyl)quinazolin-4-yl]amino]benzamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-[[7-(trifluoromethyl)quinazolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 21273959 |
| Molecular Formula | C23H24F3N5O |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-4-[[7-(trifluoromethyl)quinazolin-4-yl]amino]benzamide |
| SMILES | CCN1CCCC1CNC(=O)c1ccc(Nc2ncnc3cc(C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C23H24F3N5O/c1-2-31-11-3-4-18(31)13-27-22(32)15-5-8-17(9-6-15)30-21-19-10-7-16(23(24,25)26)12-20(19)28-14-29-21/h5-10,12,14,18H,2-4,11,13H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | IZUJYHCNSJZLMO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |