About dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane
dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane (PubChem CID 142542885) has the molecular formula C11H10F3IN2O
and a molecular weight of 370.11 g/mol. Its IUPAC name is dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane.
Molecular Properties
| Compound Name | dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane |
| PubChem CID | 142542885 |
| Molecular Formula | C11H10F3IN2O |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane |
| SMILES | CI(C)c1ncnc2cc(OC(F)(F)F)ccc12 |
| InChI | InChI=1S/C11H10F3IN2O/c1-15(2)10-8-4-3-7(18-11(12,13)14)5-9(8)16-6-17-10/h3-6H,1-2H3 |
| InChIKey | DOEIQOGLQAZEOU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane?
The IUPAC name of dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane (CID 142542885) is dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane.
What is the SMILES notation for dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane?
The canonical SMILES for dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane is CI(C)c1ncnc2cc(OC(F)(F)F)ccc12.
What is the InChIKey of dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane?
The InChIKey is DOEIQOGLQAZEOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3IN2O/c1-15(2)10-8-4-3-7(18-11(12,13)14)5-9(8)16-6-17-10/h3-6H,1-2H3.
What are the key properties of dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane?
dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane has a molecular weight of 370.11 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[7-(trifluoromethoxy)quinazolin-4-yl]-λ3-iodane is sourced from PubChem (CID 142542885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).