C20H21F3N4O3S — CID 126745192
1-(4-hydroxypiperidin-1-yl)-2-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]sulfanylprop-2-en-1-one (PubChem CID 126745192) has the molecular formula C20H21F3N4O3S and a molecular weight of 454.47 g/mol. Its IUPAC name is 1-(4-hydroxypiperidin-1-yl)-2-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]sulfanylprop-2-en-1-one.
| Compound Name | 1-(4-hydroxypiperidin-1-yl)-2-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]sulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 126745192 |
| Molecular Formula | C20H21F3N4O3S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-(4-hydroxypiperidin-1-yl)-2-[5-methyl-6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]sulfanylprop-2-en-1-one |
| SMILES | C=C(Sc1ncnc(Nc2ccc(OC(F)(F)F)cc2)c1C)C(=O)N1CCC(O)CC1 |
| InChI | InChI=1S/C20H21F3N4O3S/c1-12-17(26-14-3-5-16(6-4-14)30-20(21,22)23)24-11-25-18(12)31-13(2)19(29)27-9-7-15(28)8-10-27/h3-6,11,15,28H,2,7-10H2,1H3,(H,24,25,26) |
| InChIKey | ODTXOLWCKKBNBK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|