C18H13F3N2O3 — CID 156565059
methyl 1-[4-(trifluoromethoxy)anilino]isoquinoline-6-carboxylate (PubChem CID 156565059) has the molecular formula C18H13F3N2O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is methyl 1-[4-(trifluoromethoxy)anilino]isoquinoline-6-carboxylate.
| Compound Name | methyl 1-[4-(trifluoromethoxy)anilino]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 156565059 |
| Molecular Formula | C18H13F3N2O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 1-[4-(trifluoromethoxy)anilino]isoquinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(Nc3ccc(OC(F)(F)F)cc3)nccc2c1 |
| InChI | InChI=1S/C18H13F3N2O3/c1-25-17(24)12-2-7-15-11(10-12)8-9-22-16(15)23-13-3-5-14(6-4-13)26-18(19,20)21/h2-10H,1H3,(H,22,23) |
| InChIKey | CTBIXJSJEGMIHP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |