C15H11F3N4O2 — CID 142705520
7-methyl-4-[4-(trifluoromethoxy)anilino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 142705520) has the molecular formula C15H11F3N4O2 and a molecular weight of 336.27 g/mol. Its IUPAC name is 7-methyl-4-[4-(trifluoromethoxy)anilino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 7-methyl-4-[4-(trifluoromethoxy)anilino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 142705520 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 7-methyl-4-[4-(trifluoromethoxy)anilino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | Cn1c(C=O)cc2c(Nc3ccc(OC(F)(F)F)cc3)ncnc21 |
| InChI | InChI=1S/C15H11F3N4O2/c1-22-10(7-23)6-12-13(19-8-20-14(12)22)21-9-2-4-11(5-3-9)24-15(16,17)18/h2-8H,1H3,(H,19,20,21) |
| InChIKey | UFDLLSXBKISSOK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|