C17H18F3N3O2 — CID 159074222
6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine;dihydrate (PubChem CID 159074222) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine;dihydrate.
| Compound Name | 6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine;dihydrate |
|---|---|
| PubChem CID | 159074222 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine;dihydrate |
| SMILES | Cc1cc2ncnc(Nc3ccccc3C(F)(F)F)c2cc1C.O.O |
| InChI | InChI=1S/C17H14F3N3.2H2O/c1-10-7-12-15(8-11(10)2)21-9-22-16(12)23-14-6-4-3-5-13(14)17(18,19)20;;/h3-9H,1-2H3,(H,21,22,23);2*1H2 |
| InChIKey | WDFDYDLHMAYCBI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |