C20H21N3O3 — CID 159185240
1-[(6,7-dimethylquinazolin-4-yl)amino]naphthalen-2-ol;dihydrate (PubChem CID 159185240) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[(6,7-dimethylquinazolin-4-yl)amino]naphthalen-2-ol;dihydrate.
| Compound Name | 1-[(6,7-dimethylquinazolin-4-yl)amino]naphthalen-2-ol;dihydrate |
|---|---|
| PubChem CID | 159185240 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[(6,7-dimethylquinazolin-4-yl)amino]naphthalen-2-ol;dihydrate |
| SMILES | Cc1cc2ncnc(Nc3c(O)ccc4ccccc34)c2cc1C.O.O |
| InChI | InChI=1S/C20H17N3O.2H2O/c1-12-9-16-17(10-13(12)2)21-11-22-20(16)23-19-15-6-4-3-5-14(15)7-8-18(19)24;;/h3-11,24H,1-2H3,(H,21,22,23);2*1H2 |
| InChIKey | UYSBEPMWWVKUQD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 121.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|