C17H16BrN3O — CID 18685581
[5-bromo-2-[(6,7-dimethylquinazolin-4-yl)amino]phenyl]methanol (PubChem CID 18685581) has the molecular formula C17H16BrN3O and a molecular weight of 358.24 g/mol. Its IUPAC name is [5-bromo-2-[(6,7-dimethylquinazolin-4-yl)amino]phenyl]methanol.
| Compound Name | [5-bromo-2-[(6,7-dimethylquinazolin-4-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 18685581 |
| Molecular Formula | C17H16BrN3O |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | [5-bromo-2-[(6,7-dimethylquinazolin-4-yl)amino]phenyl]methanol |
| SMILES | Cc1cc2ncnc(Nc3ccc(Br)cc3CO)c2cc1C |
| InChI | InChI=1S/C17H16BrN3O/c1-10-5-14-16(6-11(10)2)19-9-20-17(14)21-15-4-3-13(18)7-12(15)8-22/h3-7,9,22H,8H2,1-2H3,(H,19,20,21) |
| InChIKey | AHFUKMQHJWEBRY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |