C22H30N4 — CID 142974670
but-1-ene;3-N-(6,7-dimethylquinazolin-4-yl)benzene-1,3-diamine;ethane (PubChem CID 142974670) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is but-1-ene;3-N-(6,7-dimethylquinazolin-4-yl)benzene-1,3-diamine;ethane.
| Compound Name | but-1-ene;3-N-(6,7-dimethylquinazolin-4-yl)benzene-1,3-diamine;ethane |
|---|---|
| PubChem CID | 142974670 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | but-1-ene;3-N-(6,7-dimethylquinazolin-4-yl)benzene-1,3-diamine;ethane |
| SMILES | C=CCC.CC.Cc1cc2ncnc(Nc3cccc(N)c3)c2cc1C |
| InChI | InChI=1S/C16H16N4.C4H8.C2H6/c1-10-6-14-15(7-11(10)2)18-9-19-16(14)20-13-5-3-4-12(17)8-13;1-3-4-2;1-2/h3-9H,17H2,1-2H3,(H,18,19,20);3H,1,4H2,2H3;1-2H3 |
| InChIKey | UUOSDBOMLXOSFR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|