C14H11FN4 — CID 11379777
4-N-(2-fluorophenyl)quinazoline-4,6-diamine (PubChem CID 11379777) has the molecular formula C14H11FN4 and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-N-(2-fluorophenyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(2-fluorophenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 11379777 |
| Molecular Formula | C14H11FN4 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-N-(2-fluorophenyl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccccc3[18F])c2c1 |
| InChI | InChI=1S/C14H11FN4/c15-11-3-1-2-4-13(11)19-14-10-7-9(16)5-6-12(10)17-8-18-14/h1-8H,16H2,(H,17,18,19)/i15-1 |
| InChIKey | ABEZLFGWUPMVQE-HUYCHCPVSA-N |
| XLogP | 3.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|