C14H10ClIN4 — CID 107634128
4-N-(4-chloro-2-iodophenyl)quinazoline-4,6-diamine (PubChem CID 107634128) has the molecular formula C14H10ClIN4 and a molecular weight of 396.62 g/mol. Its IUPAC name is 4-N-(4-chloro-2-iodophenyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(4-chloro-2-iodophenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 107634128 |
| Molecular Formula | C14H10ClIN4 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 4-N-(4-chloro-2-iodophenyl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccc(Cl)cc3I)c2c1 |
| InChI | InChI=1S/C14H10ClIN4/c15-8-1-3-13(11(16)5-8)20-14-10-6-9(17)2-4-12(10)18-7-19-14/h1-7H,17H2,(H,18,19,20) |
| InChIKey | QBHUXXCARMTYRN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|