C14H8Cl2FN3 — CID 110434593
N-(2,5-dichlorophenyl)-6-fluoroquinazolin-4-amine (PubChem CID 110434593) has the molecular formula C14H8Cl2FN3 and a molecular weight of 308.14 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-6-fluoroquinazolin-4-amine.
| Compound Name | N-(2,5-dichlorophenyl)-6-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 110434593 |
| Molecular Formula | C14H8Cl2FN3 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | N-(2,5-dichlorophenyl)-6-fluoroquinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(Nc3cc(Cl)ccc3Cl)c2c1 |
| InChI | InChI=1S/C14H8Cl2FN3/c15-8-1-3-11(16)13(5-8)20-14-10-6-9(17)2-4-12(10)18-7-19-14/h1-7H,(H,18,19,20) |
| InChIKey | ZJENIGILFLARPC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |