C20H12ClF2N3O — CID 86766693
3-[[6-(4-chlorophenyl)quinazolin-4-yl]amino]-2,6-difluorophenol (PubChem CID 86766693) has the molecular formula C20H12ClF2N3O and a molecular weight of 383.79 g/mol. Its IUPAC name is 3-[[6-(4-chlorophenyl)quinazolin-4-yl]amino]-2,6-difluorophenol.
| Compound Name | 3-[[6-(4-chlorophenyl)quinazolin-4-yl]amino]-2,6-difluorophenol |
|---|---|
| PubChem CID | 86766693 |
| Molecular Formula | C20H12ClF2N3O |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 3-[[6-(4-chlorophenyl)quinazolin-4-yl]amino]-2,6-difluorophenol |
| SMILES | Oc1c(F)ccc(Nc2ncnc3ccc(-c4ccc(Cl)cc4)cc23)c1F |
| InChI | InChI=1S/C20H12ClF2N3O/c21-13-4-1-11(2-5-13)12-3-7-16-14(9-12)20(25-10-24-16)26-17-8-6-15(22)19(27)18(17)23/h1-10,27H,(H,24,25,26) |
| InChIKey | MBPYRSULCBJQEY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |