C15H11ClFN3O — CID 86586464
N-(4-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 86586464) has the molecular formula C15H11ClFN3O and a molecular weight of 303.72 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | N-(4-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 86586464 |
| Molecular Formula | C15H11ClFN3O |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1ccc2ncnc(Nc3ccc(Cl)cc3F)c2c1 |
| InChI | InChI=1S/C15H11ClFN3O/c1-21-10-3-5-13-11(7-10)15(19-8-18-13)20-14-4-2-9(16)6-12(14)17/h2-8H,1H3,(H,18,19,20) |
| InChIKey | KCVORQQUVNLAND-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |