C19H19ClFN3O4S — CID 18753444
N-(4-chloro-2-fluorophenyl)-7-(2-ethylsulfonylethoxy)-6-methoxyquinazolin-4-amine (PubChem CID 18753444) has the molecular formula C19H19ClFN3O4S and a molecular weight of 439.90 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-7-(2-ethylsulfonylethoxy)-6-methoxyquinazolin-4-amine.
| Compound Name | N-(4-chloro-2-fluorophenyl)-7-(2-ethylsulfonylethoxy)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 18753444 |
| Molecular Formula | C19H19ClFN3O4S |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-7-(2-ethylsulfonylethoxy)-6-methoxyquinazolin-4-amine |
| SMILES | CCS(=O)(=O)CCOc1cc2ncnc(Nc3ccc(Cl)cc3F)c2cc1OC |
| InChI | InChI=1S/C19H19ClFN3O4S/c1-3-29(25,26)7-6-28-18-10-16-13(9-17(18)27-2)19(23-11-22-16)24-15-5-4-12(20)8-14(15)21/h4-5,8-11H,3,6-7H2,1-2H3,(H,22,23,24) |
| InChIKey | YWJSHLZIKPOMPY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |