C21H22ClFN4O4 — CID 91055671
2-[2-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyethylamino]-2-methoxypropanal (PubChem CID 91055671) has the molecular formula C21H22ClFN4O4 and a molecular weight of 448.88 g/mol. Its IUPAC name is 2-[2-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyethylamino]-2-methoxypropanal.
| Compound Name | 2-[2-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyethylamino]-2-methoxypropanal |
|---|---|
| PubChem CID | 91055671 |
| Molecular Formula | C21H22ClFN4O4 |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-[2-[4-(4-chloro-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxyethylamino]-2-methoxypropanal |
| SMILES | COc1cc2c(Nc3ccc(Cl)cc3F)ncnc2cc1OCCNC(C)(C=O)OC |
| InChI | InChI=1S/C21H22ClFN4O4/c1-21(11-28,30-3)26-6-7-31-19-10-17-14(9-18(19)29-2)20(25-12-24-17)27-16-5-4-13(22)8-15(16)23/h4-5,8-12,26H,6-7H2,1-3H3,(H,24,25,27) |
| InChIKey | FMZJZNDHACPUOH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|