C14H7ClF2N4O2 — CID 66608541
N-(3-chloro-2,4-difluorophenyl)-6-nitroquinazolin-4-amine (PubChem CID 66608541) has the molecular formula C14H7ClF2N4O2 and a molecular weight of 336.69 g/mol. Its IUPAC name is N-(3-chloro-2,4-difluorophenyl)-6-nitroquinazolin-4-amine.
| Compound Name | N-(3-chloro-2,4-difluorophenyl)-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 66608541 |
| Molecular Formula | C14H7ClF2N4O2 |
| Molecular Weight | 336.69 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-(3-chloro-2,4-difluorophenyl)-6-nitroquinazolin-4-amine |
| SMILES | O=[N+]([O-])c1ccc2ncnc(Nc3ccc(F)c(Cl)c3F)c2c1 |
| InChI | InChI=1S/C14H7ClF2N4O2/c15-12-9(16)2-4-11(13(12)17)20-14-8-5-7(21(22)23)1-3-10(8)18-6-19-14/h1-6H,(H,18,19,20) |
| InChIKey | BJZSEMDMSPFDNV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|