C13H7ClF2N4 — CID 166539805
6-chloro-N-(2,3-difluorophenyl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 166539805) has the molecular formula C13H7ClF2N4 and a molecular weight of 292.68 g/mol. Its IUPAC name is 6-chloro-N-(2,3-difluorophenyl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(2,3-difluorophenyl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166539805 |
| Molecular Formula | C13H7ClF2N4 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 6-chloro-N-(2,3-difluorophenyl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Fc1cccc(Nc2ncnc3cnc(Cl)cc23)c1F |
| InChI | InChI=1S/C13H7ClF2N4/c14-11-4-7-10(5-17-11)18-6-19-13(7)20-9-3-1-2-8(15)12(9)16/h1-6H,(H,18,19,20) |
| InChIKey | BJXMMGJOFSXCIW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|