C15H11ClFN3 — CID 78901321
N-[(3-chlorophenyl)methyl]-6-fluoroquinazolin-4-amine (PubChem CID 78901321) has the molecular formula C15H11ClFN3 and a molecular weight of 287.73 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-6-fluoroquinazolin-4-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-6-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 78901321 |
| Molecular Formula | C15H11ClFN3 |
| Molecular Weight | 287.73 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-6-fluoroquinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NCc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C15H11ClFN3/c16-11-3-1-2-10(6-11)8-18-15-13-7-12(17)4-5-14(13)19-9-20-15/h1-7,9H,8H2,(H,18,19,20) |
| InChIKey | RNOJCGONGCNCNH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.73 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |