C16H11F4N3 — CID 142682778
7-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 142682778) has the molecular formula C16H11F4N3 and a molecular weight of 321.28 g/mol. Its IUPAC name is 7-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 7-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 142682778 |
| Molecular Formula | C16H11F4N3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 7-fluoro-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | Fc1ccc2c(NCc3cccc(C(F)(F)F)c3)ncnc2c1 |
| InChI | InChI=1S/C16H11F4N3/c17-12-4-5-13-14(7-12)22-9-23-15(13)21-8-10-2-1-3-11(6-10)16(18,19)20/h1-7,9H,8H2,(H,21,22,23) |
| InChIKey | FRQOKXQAGGYSCE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |