C14H9BrCl2N4 — CID 107786960
4-N-(4-bromo-2,3-dichlorophenyl)quinazoline-4,6-diamine (PubChem CID 107786960) has the molecular formula C14H9BrCl2N4 and a molecular weight of 384.06 g/mol. Its IUPAC name is 4-N-(4-bromo-2,3-dichlorophenyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(4-bromo-2,3-dichlorophenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 107786960 |
| Molecular Formula | C14H9BrCl2N4 |
| Molecular Weight | 384.06 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 4-N-(4-bromo-2,3-dichlorophenyl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccc(Br)c(Cl)c3Cl)c2c1 |
| InChI | InChI=1S/C14H9BrCl2N4/c15-9-2-4-11(13(17)12(9)16)21-14-8-5-7(18)1-3-10(8)19-6-20-14/h1-6H,18H2,(H,19,20,21) |
| InChIKey | YXCYDEAQSGPBAO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.06 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|