C15H10BrCl2N3 — CID 107787021
6-N-(4-bromo-2,3-dichlorophenyl)quinoline-5,6-diamine (PubChem CID 107787021) has the molecular formula C15H10BrCl2N3 and a molecular weight of 383.08 g/mol. Its IUPAC name is 6-N-(4-bromo-2,3-dichlorophenyl)quinoline-5,6-diamine.
| Compound Name | 6-N-(4-bromo-2,3-dichlorophenyl)quinoline-5,6-diamine |
|---|---|
| PubChem CID | 107787021 |
| Molecular Formula | C15H10BrCl2N3 |
| Molecular Weight | 383.08 g/mol |
| Exact Mass | 380.94 |
| IUPAC Name | 6-N-(4-bromo-2,3-dichlorophenyl)quinoline-5,6-diamine |
| SMILES | Nc1c(Nc2ccc(Br)c(Cl)c2Cl)ccc2ncccc12 |
| InChI | InChI=1S/C15H10BrCl2N3/c16-9-3-4-11(14(18)13(9)17)21-12-6-5-10-8(15(12)19)2-1-7-20-10/h1-7,21H,19H2 |
| InChIKey | QOPNEISHESBKJV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.08 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|