C15H11Br2N3 — CID 107596522
6-N-(2,6-dibromophenyl)quinoline-5,6-diamine (PubChem CID 107596522) has the molecular formula C15H11Br2N3 and a molecular weight of 393.08 g/mol. Its IUPAC name is 6-N-(2,6-dibromophenyl)quinoline-5,6-diamine.
| Compound Name | 6-N-(2,6-dibromophenyl)quinoline-5,6-diamine |
|---|---|
| PubChem CID | 107596522 |
| Molecular Formula | C15H11Br2N3 |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.93 |
| IUPAC Name | 6-N-(2,6-dibromophenyl)quinoline-5,6-diamine |
| SMILES | Nc1c(Nc2c(Br)cccc2Br)ccc2ncccc12 |
| InChI | InChI=1S/C15H11Br2N3/c16-10-4-1-5-11(17)15(10)20-13-7-6-12-9(14(13)18)3-2-8-19-12/h1-8,20H,18H2 |
| InChIKey | ZZVZSUOQKTZUKZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|