C15H21N3 — CID 89050951
6-N-(3,3-dimethylbutyl)quinoline-5,6-diamine (PubChem CID 89050951) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 6-N-(3,3-dimethylbutyl)quinoline-5,6-diamine.
| Compound Name | 6-N-(3,3-dimethylbutyl)quinoline-5,6-diamine |
|---|---|
| PubChem CID | 89050951 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 6-N-(3,3-dimethylbutyl)quinoline-5,6-diamine |
| SMILES | CC(C)(C)CCNc1ccc2ncccc2c1N |
| InChI | InChI=1S/C15H21N3/c1-15(2,3)8-10-18-13-7-6-12-11(14(13)16)5-4-9-17-12/h4-7,9,18H,8,10,16H2,1-3H3 |
| InChIKey | KPDMHUSJBJPKES-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|