C15H22N4O — CID 62844494
6-N-[2-[2-methoxyethyl(methyl)amino]ethyl]quinoline-5,6-diamine (PubChem CID 62844494) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-N-[2-[2-methoxyethyl(methyl)amino]ethyl]quinoline-5,6-diamine.
| Compound Name | 6-N-[2-[2-methoxyethyl(methyl)amino]ethyl]quinoline-5,6-diamine |
|---|---|
| PubChem CID | 62844494 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 6-N-[2-[2-methoxyethyl(methyl)amino]ethyl]quinoline-5,6-diamine |
| SMILES | COCCN(C)CCNc1ccc2ncccc2c1N |
| InChI | InChI=1S/C15H22N4O/c1-19(10-11-20-2)9-8-18-14-6-5-13-12(15(14)16)4-3-7-17-13/h3-7,18H,8-11,16H2,1-2H3 |
| InChIKey | UHAHZKJUMDOKHX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|