C12H13N3 — CID 62500024
6-N-prop-2-enylquinoline-5,6-diamine (PubChem CID 62500024) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 6-N-prop-2-enylquinoline-5,6-diamine.
| Compound Name | 6-N-prop-2-enylquinoline-5,6-diamine |
|---|---|
| PubChem CID | 62500024 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 6-N-prop-2-enylquinoline-5,6-diamine |
| SMILES | C=CCNc1ccc2ncccc2c1N |
| InChI | InChI=1S/C12H13N3/c1-2-7-14-11-6-5-10-9(12(11)13)4-3-8-15-10/h2-6,8,14H,1,7,13H2 |
| InChIKey | WPGQNWASIPVXSB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|