C15H13FN4 — CID 64590253
4-N-[(2-fluorophenyl)methyl]quinazoline-4,6-diamine (PubChem CID 64590253) has the molecular formula C15H13FN4 and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-N-[(2-fluorophenyl)methyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[(2-fluorophenyl)methyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64590253 |
| Molecular Formula | C15H13FN4 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-N-[(2-fluorophenyl)methyl]quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(NCc3ccccc3F)c2c1 |
| InChI | InChI=1S/C15H13FN4/c16-13-4-2-1-3-10(13)8-18-15-12-7-11(17)5-6-14(12)19-9-20-15/h1-7,9H,8,17H2,(H,18,19,20) |
| InChIKey | XHDQQSXBBHQZRA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|