C13H11ClN4S — CID 64589914
4-N-[(5-chlorothiophen-2-yl)methyl]quinazoline-4,6-diamine (PubChem CID 64589914) has the molecular formula C13H11ClN4S and a molecular weight of 290.78 g/mol. Its IUPAC name is 4-N-[(5-chlorothiophen-2-yl)methyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[(5-chlorothiophen-2-yl)methyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64589914 |
| Molecular Formula | C13H11ClN4S |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-N-[(5-chlorothiophen-2-yl)methyl]quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(NCc3ccc(Cl)s3)c2c1 |
| InChI | InChI=1S/C13H11ClN4S/c14-12-4-2-9(19-12)6-16-13-10-5-8(15)1-3-11(10)17-7-18-13/h1-5,7H,6,15H2,(H,16,17,18) |
| InChIKey | VXTUHJBJPWPEHO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|