C14H12ClN3S — CID 103001265
4-N-[(5-chlorothiophen-2-yl)methyl]quinoline-4,7-diamine (PubChem CID 103001265) has the molecular formula C14H12ClN3S and a molecular weight of 289.79 g/mol. Its IUPAC name is 4-N-[(5-chlorothiophen-2-yl)methyl]quinoline-4,7-diamine.
| Compound Name | 4-N-[(5-chlorothiophen-2-yl)methyl]quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103001265 |
| Molecular Formula | C14H12ClN3S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 4-N-[(5-chlorothiophen-2-yl)methyl]quinoline-4,7-diamine |
| SMILES | Nc1ccc2c(NCc3ccc(Cl)s3)ccnc2c1 |
| InChI | InChI=1S/C14H12ClN3S/c15-14-4-2-10(19-14)8-18-12-5-6-17-13-7-9(16)1-3-11(12)13/h1-7H,8,16H2,(H,17,18) |
| InChIKey | VOQGIWUAAABXSO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|