C17H25N3 — CID 103000881
4-N-(2,4,4-trimethylpentan-2-yl)quinoline-4,7-diamine (PubChem CID 103000881) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 4-N-(2,4,4-trimethylpentan-2-yl)quinoline-4,7-diamine.
| Compound Name | 4-N-(2,4,4-trimethylpentan-2-yl)quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103000881 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 4-N-(2,4,4-trimethylpentan-2-yl)quinoline-4,7-diamine |
| SMILES | CC(C)(C)CC(C)(C)Nc1ccnc2cc(N)ccc12 |
| InChI | InChI=1S/C17H25N3/c1-16(2,3)11-17(4,5)20-14-8-9-19-15-10-12(18)6-7-13(14)15/h6-10H,11,18H2,1-5H3,(H,19,20) |
| InChIKey | UIGSQHQDJZHCDM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|