C31H33ClN4O4S — CID 68873709
N-(3-chloro-4-phenylmethoxyphenyl)-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine (PubChem CID 68873709) has the molecular formula C31H33ClN4O4S and a molecular weight of 593.15 g/mol. Its IUPAC name is N-(3-chloro-4-phenylmethoxyphenyl)-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-phenylmethoxyphenyl)-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68873709 |
| Molecular Formula | C31H33ClN4O4S |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N-(3-chloro-4-phenylmethoxyphenyl)-6-[2-[3-(2-methylsulfonylethylamino)propyl]-3H-furan-2-yl]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCCCC1(c2ccc3ncnc(Nc4ccc(OCc5ccccc5)c(Cl)c4)c3c2)CC=CO1 |
| InChI | InChI=1S/C31H33ClN4O4S/c1-41(37,38)18-16-33-15-5-13-31(14-6-17-40-31)24-9-11-28-26(19-24)30(35-22-34-28)36-25-10-12-29(27(32)20-25)39-21-23-7-3-2-4-8-23/h2-4,6-12,17,19-20,22,33H,5,13-16,18,21H2,1H3,(H,34,35,36) |
| InChIKey | XHMNJBNYOQEZGP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|