C33H29ClFN5O4S — CID 22018128
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-pyridin-2-ylsulfonylethylamino)methyl]-3H-furan-2-yl]quinazolin-4-amine (PubChem CID 22018128) has the molecular formula C33H29ClFN5O4S and a molecular weight of 646.14 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-pyridin-2-ylsulfonylethylamino)methyl]-3H-furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-pyridin-2-ylsulfonylethylamino)methyl]-3H-furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 22018128 |
| Molecular Formula | C33H29ClFN5O4S |
| Molecular Weight | 646.14 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[(2-pyridin-2-ylsulfonylethylamino)methyl]-3H-furan-2-yl]quinazolin-4-amine |
| SMILES | O=S(=O)(CCNCC1(c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)CC=CO1)c1ccccn1 |
| InChI | InChI=1S/C33H29ClFN5O4S/c34-28-19-26(9-11-30(28)43-20-23-5-3-6-25(35)17-23)40-32-27-18-24(8-10-29(27)38-22-39-32)33(12-4-15-44-33)21-36-14-16-45(41,42)31-7-1-2-13-37-31/h1-11,13,15,17-19,22,36H,12,14,16,20-21H2,(H,38,39,40) |
| InChIKey | YOCVOMMXXNJEQR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.14 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|