C35H32ClFN4O4S — CID 68876526
6-[2-[2-[2-(benzenesulfonyl)ethylamino]ethyl]-3H-furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine (PubChem CID 68876526) has the molecular formula C35H32ClFN4O4S and a molecular weight of 659.18 g/mol. Its IUPAC name is 6-[2-[2-[2-(benzenesulfonyl)ethylamino]ethyl]-3H-furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine.
| Compound Name | 6-[2-[2-[2-(benzenesulfonyl)ethylamino]ethyl]-3H-furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68876526 |
| Molecular Formula | C35H32ClFN4O4S |
| Molecular Weight | 659.18 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | 6-[2-[2-[2-(benzenesulfonyl)ethylamino]ethyl]-3H-furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
| SMILES | O=S(=O)(CCNCCC1(c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)CC=CO1)c1ccccc1 |
| InChI | InChI=1S/C35H32ClFN4O4S/c36-31-22-28(11-13-33(31)44-23-25-6-4-7-27(37)20-25)41-34-30-21-26(10-12-32(30)39-24-40-34)35(14-5-18-45-35)15-16-38-17-19-46(42,43)29-8-2-1-3-9-29/h1-13,18,20-22,24,38H,14-17,19,23H2,(H,39,40,41) |
| InChIKey | DVAGFZUMGGCPQU-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.18 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|