C32H32BrFN4O4S — CID 87608953
N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(3-methyl-2-sulfonylbutyl)amino]ethyl]-3H-furan-2-yl]quinazolin-4-amine (PubChem CID 87608953) has the molecular formula C32H32BrFN4O4S and a molecular weight of 667.60 g/mol. Its IUPAC name is N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(3-methyl-2-sulfonylbutyl)amino]ethyl]-3H-furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(3-methyl-2-sulfonylbutyl)amino]ethyl]-3H-furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 87608953 |
| Molecular Formula | C32H32BrFN4O4S |
| Molecular Weight | 667.60 g/mol |
| Exact Mass | 666.13 |
| IUPAC Name | N-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-[2-[(3-methyl-2-sulfonylbutyl)amino]ethyl]-3H-furan-2-yl]quinazolin-4-amine |
| SMILES | CC(C)C(CNCCC1(c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Br)c4)c3c2)CC=CO1)=S(=O)=O |
| InChI | InChI=1S/C32H32BrFN4O4S/c1-21(2)30(43(39)40)18-35-13-12-32(11-4-14-42-32)23-7-9-28-26(16-23)31(37-20-36-28)38-25-8-10-29(27(33)17-25)41-19-22-5-3-6-24(34)15-22/h3-10,14-17,20-21,35H,11-13,18-19H2,1-2H3,(H,36,37,38) |
| InChIKey | MPHTVUUHYYKHBY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|